CAS:25016-11-9|1-Methyl-1H-pyrazole-4-carbaldehyde
Molecular Formula:C5H6N2O
Molecular Weight:110.11 g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- Pristatymas visame pasaulyje
- Kokybės užtikrinimas
- 24/7 klientų aptarnavimas
produkto pristatymas
1-Methyl-1H-pyrazole-4-carbaldehyde(CAS:25016-11-9) has been used in a variety of scientific research applications. It has been used as a starting material in the synthesis of various compounds, including 1-1-Methyl-1H-pyrazole-4-carbaldehyde-1H-pyrazole-4-carboxylic acid, which is a useful intermediate in the synthesis of various pharmaceuticals. Additionally, it has been used in the investigation of the biochemical and physiological effects of certain drugs, such as the anticonvulsant drug phenytoin.
|
|
|
| 1-methylpyrazole-4-carbaldehyde | |
| MFCD00460465 | |
| 29-34ºC | |
| 218.9ºC at 760 mmHg | |
| 110ºC | |
| 1.14 g/cm3 | |
| 34.89 | |
| 0.23 | |
| 0.0003mmHg at 25 degree | |
| 1.502 | |
| Inert atmosphere,2-8 degree | |
| InChI=1S/C5H6N2O/c1-7-3-5(4-8)2-6-7/h2-4H,1H3 | |
| MYFZXSOYJVWTBL-UHFFFAOYSA-N |
Populiarus Žymos: cas:25016-11-9|1-methyl-1h-pyrazole-4-carbaldehyde, price, quotation, discount, in stock, for sale
